C33H34ClN7O5 — CID 170978618
6-[[4-[(3R)-5-[(5-chloro-1-methyl-6-oxopyridazin-4-yl)amino]-1-methylpiperidin-3-yl]phenyl]methyl]-2-(2,6-dioxopiperidin-3-yl)-5,7-dihydropyrrolo[3,4-f]isoindole-1,3-dione (PubChem CID 170978618) has the molecular formula C33H34ClN7O5 and a molecular weight of 644.13 g/mol. Its IUPAC name is 6-[[4-[(3R)-5-[(5-chloro-1-methyl-6-oxopyridazin-4-yl)amino]-1-methylpiperidin-3-yl]phenyl]methyl]-2-(2,6-dioxopiperidin-3-yl)-5,7-dihydropyrrolo[3,4-f]isoindole-1,3-dione.
| Compound Name | 6-[[4-[(3R)-5-[(5-chloro-1-methyl-6-oxopyridazin-4-yl)amino]-1-methylpiperidin-3-yl]phenyl]methyl]-2-(2,6-dioxopiperidin-3-yl)-5,7-dihydropyrrolo[3,4-f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 170978618 |
| Molecular Formula | C33H34ClN7O5 |
| Molecular Weight | 644.13 g/mol |
| Exact Mass | 643.23 |
| IUPAC Name | 6-[[4-[(3R)-5-[(5-chloro-1-methyl-6-oxopyridazin-4-yl)amino]-1-methylpiperidin-3-yl]phenyl]methyl]-2-(2,6-dioxopiperidin-3-yl)-5,7-dihydropyrrolo[3,4-f]isoindole-1,3-dione |
| SMILES | CN1CC(Nc2cnn(C)c(=O)c2Cl)C[C@H](c2ccc(CN3Cc4cc5c(cc4C3)C(=O)N(C3CCC(=O)NC3=O)C5=O)cc2)C1 |
| InChI | InChI=1S/C33H34ClN7O5/c1-38-14-20(9-23(17-38)36-26-12-35-39(2)33(46)29(26)34)19-5-3-18(4-6-19)13-40-15-21-10-24-25(11-22(21)16-40)32(45)41(31(24)44)27-7-8-28(42)37-30(27)43/h3-6,10-12,20,23,27,36H,7-9,13-17H2,1-2H3,(H,37,42,43)/t20-,23?,27?/m0/s1 |
| InChIKey | JXJWPBJILHXUHZ-RQOXUDFDSA-N |
| XLogP | 2.25 |
| TPSA | 136.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.13 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|