C33H34BrN7O5 — CID 170978690
6-[[4-[(3R,5R)-5-[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]-1-methylpiperidin-3-yl]phenyl]methyl]-2-(2,6-dioxopiperidin-3-yl)-5,7-dihydropyrrolo[3,4-f]isoindole-1,3-dione (PubChem CID 170978690) has the molecular formula C33H34BrN7O5 and a molecular weight of 688.58 g/mol. Its IUPAC name is 6-[[4-[(3R,5R)-5-[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]-1-methylpiperidin-3-yl]phenyl]methyl]-2-(2,6-dioxopiperidin-3-yl)-5,7-dihydropyrrolo[3,4-f]isoindole-1,3-dione.
| Compound Name | 6-[[4-[(3R,5R)-5-[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]-1-methylpiperidin-3-yl]phenyl]methyl]-2-(2,6-dioxopiperidin-3-yl)-5,7-dihydropyrrolo[3,4-f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 170978690 |
| Molecular Formula | C33H34BrN7O5 |
| Molecular Weight | 688.58 g/mol |
| Exact Mass | 687.18 |
| IUPAC Name | 6-[[4-[(3R,5R)-5-[(5-bromo-1-methyl-6-oxopyridazin-4-yl)amino]-1-methylpiperidin-3-yl]phenyl]methyl]-2-(2,6-dioxopiperidin-3-yl)-5,7-dihydropyrrolo[3,4-f]isoindole-1,3-dione |
| SMILES | CN1C[C@H](Nc2cnn(C)c(=O)c2Br)C[C@H](c2ccc(CN3Cc4cc5c(cc4C3)C(=O)N(C3CCC(=O)NC3=O)C5=O)cc2)C1 |
| InChI | InChI=1S/C33H34BrN7O5/c1-38-14-20(9-23(17-38)36-26-12-35-39(2)33(46)29(26)34)19-5-3-18(4-6-19)13-40-15-21-10-24-25(11-22(21)16-40)32(45)41(31(24)44)27-7-8-28(42)37-30(27)43/h3-6,10-12,20,23,27,36H,7-9,13-17H2,1-2H3,(H,37,42,43)/t20-,23+,27?/m0/s1 |
| InChIKey | SSSPUAZKUZPRBM-XGHRBMDCSA-N |
| XLogP | 2.36 |
| TPSA | 136.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.58 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|