C19H25F3N6O2 — CID 170980434
3-[(E)-N-[(E)-1-amino-2-[amino(propan-2-yl)amino]ethenyl]-C-ethylcarbonimidoyl]-2-hydroxy-N-(2,2,2-trifluoroethyl)-1H-indole-5-carboxamide (PubChem CID 170980434) has the molecular formula C19H25F3N6O2 and a molecular weight of 426.44 g/mol. Its IUPAC name is 3-[(E)-N-[(E)-1-amino-2-[amino(propan-2-yl)amino]ethenyl]-C-ethylcarbonimidoyl]-2-hydroxy-N-(2,2,2-trifluoroethyl)-1H-indole-5-carboxamide.
| Compound Name | 3-[(E)-N-[(E)-1-amino-2-[amino(propan-2-yl)amino]ethenyl]-C-ethylcarbonimidoyl]-2-hydroxy-N-(2,2,2-trifluoroethyl)-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 170980434 |
| Molecular Formula | C19H25F3N6O2 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 3-[(E)-N-[(E)-1-amino-2-[amino(propan-2-yl)amino]ethenyl]-C-ethylcarbonimidoyl]-2-hydroxy-N-(2,2,2-trifluoroethyl)-1H-indole-5-carboxamide |
| SMILES | CC/C(=N\C(N)=C\N(N)C(C)C)c1c(O)[nH]c2ccc(C(=O)NCC(F)(F)F)cc12 |
| InChI | InChI=1S/C19H25F3N6O2/c1-4-13(26-15(23)8-28(24)10(2)3)16-12-7-11(5-6-14(12)27-18(16)30)17(29)25-9-19(20,21)22/h5-8,10,27,30H,4,9,23-24H2,1-3H3,(H,25,29)/b15-8+,26-13+ |
| InChIKey | UFKTVTSDOPZEEQ-SCQVXGNVSA-N |
| XLogP | 2.71 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|