C27H30F3N5O2 — CID 170980443
3-[N-[4-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]phenyl]-C-ethylcarbonimidoyl]-2-hydroxy-N-(2,2,2-trifluoroethyl)-1H-indole-5-carboxamide (PubChem CID 170980443) has the molecular formula C27H30F3N5O2 and a molecular weight of 513.56 g/mol. Its IUPAC name is 3-[N-[4-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]phenyl]-C-ethylcarbonimidoyl]-2-hydroxy-N-(2,2,2-trifluoroethyl)-1H-indole-5-carboxamide.
| Compound Name | 3-[N-[4-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]phenyl]-C-ethylcarbonimidoyl]-2-hydroxy-N-(2,2,2-trifluoroethyl)-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 170980443 |
| Molecular Formula | C27H30F3N5O2 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 3-[N-[4-[(3aR,6aS)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]phenyl]-C-ethylcarbonimidoyl]-2-hydroxy-N-(2,2,2-trifluoroethyl)-1H-indole-5-carboxamide |
| SMILES | CC/C(=N\c1ccc(N2C[C@H]3CN(C)C[C@H]3C2)cc1)c1c(O)[nH]c2ccc(C(=O)NCC(F)(F)F)cc12 |
| InChI | InChI=1S/C27H30F3N5O2/c1-3-22(32-19-5-7-20(8-6-19)35-13-17-11-34(2)12-18(17)14-35)24-21-10-16(4-9-23(21)33-26(24)37)25(36)31-15-27(28,29)30/h4-10,17-18,33,37H,3,11-15H2,1-2H3,(H,31,36)/b32-22+/t17-,18+ |
| InChIKey | WWTJLQMYBVMEFE-KLCUYUNRSA-N |
| XLogP | 4.69 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|