About ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane
ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 170980461) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane |
| PubChem CID | 170980461 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | CC.CC(C)N1CC2CC1CN2 |
| InChI | InChI=1S/C8H16N2.C2H6/c1-6(2)10-5-7-3-8(10)4-9-7;1-2/h6-9H,3-5H2,1-2H3;1-2H3 |
| InChIKey | YWLRLOCWVYEDFW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane?
The IUPAC name of ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane (CID 170980461) is ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane.
What is the SMILES notation for ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane?
The canonical SMILES for ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane is CC.CC(C)N1CC2CC1CN2.
What is the InChIKey of ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane?
The InChIKey is YWLRLOCWVYEDFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.C2H6/c1-6(2)10-5-7-3-8(10)4-9-7;1-2/h6-9H,3-5H2,1-2H3;1-2H3.
What are the key properties of ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane?
ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane has a molecular weight of 170.30 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane is sourced from PubChem (CID 170980461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).