C10H22N2 — CID 170980461
ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 170980461) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 170980461 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | ethane;2-propan-2-yl-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | CC.CC(C)N1CC2CC1CN2 |
| InChI | InChI=1S/C8H16N2.C2H6/c1-6(2)10-5-7-3-8(10)4-9-7;1-2/h6-9H,3-5H2,1-2H3;1-2H3 |
| InChIKey | YWLRLOCWVYEDFW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |