C6H12N2 — CID 11029795
(1S,4S)-2-methyl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 11029795) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is (1S,4S)-2-methyl-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | (1S,4S)-2-methyl-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 11029795 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (1S,4S)-2-methyl-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | CN1C[C@@H]2C[C@H]1CN2 |
| InChI | InChI=1S/C6H12N2/c1-8-4-5-2-6(8)3-7-5/h5-7H,2-4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | YFDRYBUJCGOYCQ-WDSKDSINSA-N |
| XLogP | -0.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |