C12H20N2 — CID 170980463
ethane;N-methyl-N-[(Z)-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]methanamine (PubChem CID 170980463) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is ethane;N-methyl-N-[(Z)-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]methanamine.
| Compound Name | ethane;N-methyl-N-[(Z)-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]methanamine |
|---|---|
| PubChem CID | 170980463 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | ethane;N-methyl-N-[(Z)-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]methanamine |
| SMILES | C=C1C=C(C)C=C/C1=N/N(C)C.CC |
| InChI | InChI=1S/C10H14N2.C2H6/c1-8-5-6-10(9(2)7-8)11-12(3)4;1-2/h5-7H,2H2,1,3-4H3;1-2H3/b11-10-; |
| InChIKey | SMFXODIYWTUIHT-GMFCBQQYSA-N |
| XLogP | 3.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|