C21H26N2+2 — CID 91024449
[4-[5-(4-dimethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)penta-1,3-dienyl]cyclohexa-2,4-dien-1-ylidene]-dimethylazanium (PubChem CID 91024449) has the molecular formula C21H26N2+2 and a molecular weight of 306.45 g/mol. Its IUPAC name is [4-[5-(4-dimethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)penta-1,3-dienyl]cyclohexa-2,4-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[5-(4-dimethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)penta-1,3-dienyl]cyclohexa-2,4-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 91024449 |
| Molecular Formula | C21H26N2+2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | [4-[5-(4-dimethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)penta-1,3-dienyl]cyclohexa-2,4-dien-1-ylidene]-dimethylazanium |
| SMILES | C[N+](C)=C1C=CC(=CC=CC=CC2=CCC(=[N+](C)C)C=C2)C=C1 |
| InChI | InChI=1S/C21H26N2/c1-22(2)20-14-10-18(11-15-20)8-6-5-7-9-19-12-16-21(17-13-19)23(3)4/h5-16H,17H2,1-4H3/q+2 |
| InChIKey | JETCFGPPYBMSJK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|