C6H6IN3O — CID 170981048
6-iodo-N-methylpyridazine-3-carboxamide (PubChem CID 170981048) has the molecular formula C6H6IN3O and a molecular weight of 263.04 g/mol. Its IUPAC name is 6-iodo-N-methylpyridazine-3-carboxamide.
| Compound Name | 6-iodo-N-methylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 170981048 |
| Molecular Formula | C6H6IN3O |
| Molecular Weight | 263.04 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | 6-iodo-N-methylpyridazine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(I)nn1 |
| InChI | InChI=1S/C6H6IN3O/c1-8-6(11)4-2-3-5(7)10-9-4/h2-3H,1H3,(H,8,11) |
| InChIKey | IZYAVZFUBWJXHZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.04 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|