C12H21N3O — CID 170981994
N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen (PubChem CID 170981994) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen.
| Compound Name | N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen |
|---|---|
| PubChem CID | 170981994 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen |
| SMILES | CCC(C)CNC(=O)CCc1cnccn1.[H][H] |
| InChI | InChI=1S/C12H19N3O.H2/c1-3-10(2)8-15-12(16)5-4-11-9-13-6-7-14-11;/h6-7,9-10H,3-5,8H2,1-2H3,(H,15,16);1H |
| InChIKey | VCSCMJJEGBFOKD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |