N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen

C12H21N3O — CID 170981994

IUPACN-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen
SMILESCCC(C)CNC(=O)CCc1cnccn1.[H][H]
InChIInChI=1S/C12H19N3O.H2/c1-3-10(2)8-15-12(16)5-4-11-9-13-6-7-14-11;/h6-7,9-10H,3-5,8H2,1-2H3,(H,15,16);1H
InChIKeyVCSCMJJEGBFOKD-UHFFFAOYSA-N
MW223.32 g/mol
LogP1.82
Rot. Bonds6

About N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen

N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen (PubChem CID 170981994) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen.

Molecular Properties

Compound NameN-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen
PubChem CID170981994
Molecular FormulaC12H21N3O
Molecular Weight223.32 g/mol
Exact Mass223.17
IUPAC NameN-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen
SMILESCCC(C)CNC(=O)CCc1cnccn1.[H][H]
InChIInChI=1S/C12H19N3O.H2/c1-3-10(2)8-15-12(16)5-4-11-9-13-6-7-14-11;/h6-7,9-10H,3-5,8H2,1-2H3,(H,15,16);1H
InChIKeyVCSCMJJEGBFOKD-UHFFFAOYSA-N
XLogP1.82
TPSA54.88 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.32
LogP ≤ 51.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen?
The IUPAC name of N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen (CID 170981994) is N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen.
What is the SMILES notation for N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen?
The canonical SMILES for N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen is CCC(C)CNC(=O)CCc1cnccn1.[H][H].
What is the InChIKey of N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen?
The InChIKey is VCSCMJJEGBFOKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O.H2/c1-3-10(2)8-15-12(16)5-4-11-9-13-6-7-14-11;/h6-7,9-10H,3-5,8H2,1-2H3,(H,15,16);1H.
What are the key properties of N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen?
N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen has a molecular weight of 223.32 g/mol, XLogP of 1.82, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylbutyl)-3-pyrazin-2-ylpropanamide;molecular hydrogen is sourced from PubChem (CID 170981994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).