C23H24N4O2 — CID 170983305
6-[4-(2-methoxyethylamino)phenyl]-5,7-dimethyl-3-phenylpyrrolo[3,4-d]pyridazin-4-one (PubChem CID 170983305) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 6-[4-(2-methoxyethylamino)phenyl]-5,7-dimethyl-3-phenylpyrrolo[3,4-d]pyridazin-4-one.
| Compound Name | 6-[4-(2-methoxyethylamino)phenyl]-5,7-dimethyl-3-phenylpyrrolo[3,4-d]pyridazin-4-one |
|---|---|
| PubChem CID | 170983305 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 6-[4-(2-methoxyethylamino)phenyl]-5,7-dimethyl-3-phenylpyrrolo[3,4-d]pyridazin-4-one |
| SMILES | COCCNc1ccc(-n2c(C)c3cnn(-c4ccccc4)c(=O)c3c2C)cc1 |
| InChI | InChI=1S/C23H24N4O2/c1-16-21-15-25-27(20-7-5-4-6-8-20)23(28)22(21)17(2)26(16)19-11-9-18(10-12-19)24-13-14-29-3/h4-12,15,24H,13-14H2,1-3H3 |
| InChIKey | AMJXQQYUYUAAJZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|