C19H24N4O2 — CID 170983638
2-tert-butyl-5-[2-[[4-(propan-2-yloxymethyl)phenyl]methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile (PubChem CID 170983638) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-tert-butyl-5-[2-[[4-(propan-2-yloxymethyl)phenyl]methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-tert-butyl-5-[2-[[4-(propan-2-yloxymethyl)phenyl]methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 170983638 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-tert-butyl-5-[2-[[4-(propan-2-yloxymethyl)phenyl]methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile |
| SMILES | CC(C)OCc1ccc(C=NNc2oc(C(C)(C)C)nc2C#N)cc1 |
| InChI | InChI=1S/C19H24N4O2/c1-13(2)24-12-15-8-6-14(7-9-15)11-21-23-17-16(10-20)22-18(25-17)19(3,4)5/h6-9,11,13,23H,12H2,1-5H3 |
| InChIKey | ITAWSDPYVVCXBF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|