C17H20N4O3 — CID 170983631
2-tert-butyl-5-[2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile (PubChem CID 170983631) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-tert-butyl-5-[2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-tert-butyl-5-[2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 170983631 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-tert-butyl-5-[2-[(2,4-dimethoxyphenyl)methylidene]hydrazinyl]-1,3-oxazole-4-carbonitrile |
| SMILES | COc1ccc(C=NNc2oc(C(C)(C)C)nc2C#N)c(OC)c1 |
| InChI | InChI=1S/C17H20N4O3/c1-17(2,3)16-20-13(9-18)15(24-16)21-19-10-11-6-7-12(22-4)8-14(11)23-5/h6-8,10,21H,1-5H3 |
| InChIKey | BZAQRAHLJQSNQW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|