C18H13BrN4O2 — CID 4067821
5-[2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-2-phenyl-1,3-oxazole-4-carbonitrile (PubChem CID 4067821) has the molecular formula C18H13BrN4O2 and a molecular weight of 397.23 g/mol. Its IUPAC name is 5-[2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-2-phenyl-1,3-oxazole-4-carbonitrile.
| Compound Name | 5-[2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-2-phenyl-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 4067821 |
| Molecular Formula | C18H13BrN4O2 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 5-[2-[(5-bromo-2-methoxyphenyl)methylidene]hydrazinyl]-2-phenyl-1,3-oxazole-4-carbonitrile |
| SMILES | COc1ccc(Br)cc1C=NNc1oc(-c2ccccc2)nc1C#N |
| InChI | InChI=1S/C18H13BrN4O2/c1-24-16-8-7-14(19)9-13(16)11-21-23-18-15(10-20)22-17(25-18)12-5-3-2-4-6-12/h2-9,11,23H,1H3 |
| InChIKey | UQQCPJWOIMOENJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|