C23H24O7 — CID 170983728
3-hydroxy-5-(methoxymethoxy)-9-(3-methoxyphenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-f]chromen-10-one (PubChem CID 170983728) has the molecular formula C23H24O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is 3-hydroxy-5-(methoxymethoxy)-9-(3-methoxyphenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-f]chromen-10-one.
| Compound Name | 3-hydroxy-5-(methoxymethoxy)-9-(3-methoxyphenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-f]chromen-10-one |
|---|---|
| PubChem CID | 170983728 |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 3-hydroxy-5-(methoxymethoxy)-9-(3-methoxyphenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-f]chromen-10-one |
| SMILES | COCOc1cc2occ(-c3cccc(OC)c3)c(=O)c2c2c1CC(O)C(C)(C)O2 |
| InChI | InChI=1S/C23H24O7/c1-23(2)19(24)9-15-17(29-12-26-3)10-18-20(22(15)30-23)21(25)16(11-28-18)13-6-5-7-14(8-13)27-4/h5-8,10-11,19,24H,9,12H2,1-4H3 |
| InChIKey | CSISHCOGFWXVOO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|