About N-hydroxy-1,2-dihydropyrimidine-2-carboxamide
N-hydroxy-1,2-dihydropyrimidine-2-carboxamide (PubChem CID 170984098) has the molecular formula C5H7N3O2
and a molecular weight of 141.13 g/mol. Its IUPAC name is N-hydroxy-1,2-dihydropyrimidine-2-carboxamide.
Molecular Properties
| Compound Name | N-hydroxy-1,2-dihydropyrimidine-2-carboxamide |
| PubChem CID | 170984098 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | N-hydroxy-1,2-dihydropyrimidine-2-carboxamide |
| SMILES | O=C(NO)C1N=CC=CN1 |
| InChI | InChI=1S/C5H7N3O2/c9-5(8-10)4-6-2-1-3-7-4/h1-4,6,10H,(H,8,9) |
| InChIKey | BDGZDGWEICSWEW-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-1,2-dihydropyrimidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-1,2-dihydropyrimidine-2-carboxamide?
The IUPAC name of N-hydroxy-1,2-dihydropyrimidine-2-carboxamide (CID 170984098) is N-hydroxy-1,2-dihydropyrimidine-2-carboxamide.
What is the SMILES notation for N-hydroxy-1,2-dihydropyrimidine-2-carboxamide?
The canonical SMILES for N-hydroxy-1,2-dihydropyrimidine-2-carboxamide is O=C(NO)C1N=CC=CN1.
What is the InChIKey of N-hydroxy-1,2-dihydropyrimidine-2-carboxamide?
The InChIKey is BDGZDGWEICSWEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2/c9-5(8-10)4-6-2-1-3-7-4/h1-4,6,10H,(H,8,9).
What are the key properties of N-hydroxy-1,2-dihydropyrimidine-2-carboxamide?
N-hydroxy-1,2-dihydropyrimidine-2-carboxamide has a molecular weight of 141.13 g/mol, XLogP of -0.99, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-1,2-dihydropyrimidine-2-carboxamide is sourced from PubChem (CID 170984098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).