C5H8ClN3O — CID 172694013
1,2-dihydropyrimidine-2-carboxamide;hydrochloride (PubChem CID 172694013) has the molecular formula C5H8ClN3O and a molecular weight of 161.59 g/mol. Its IUPAC name is 1,2-dihydropyrimidine-2-carboxamide;hydrochloride.
| Compound Name | 1,2-dihydropyrimidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 172694013 |
| Molecular Formula | C5H8ClN3O |
| Molecular Weight | 161.59 g/mol |
| Exact Mass | 161.04 |
| IUPAC Name | 1,2-dihydropyrimidine-2-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)C1N=CC=CN1 |
| InChI | InChI=1S/C5H7N3O.ClH/c6-4(9)5-7-2-1-3-8-5;/h1-3,5,7H,(H2,6,9);1H |
| InChIKey | CBNZHIQBHXKVDP-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.59 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |