C20H28N2O3S — CID 170985002
N-[4-[2-(5-amino-3-tert-butyl-2-methoxyphenyl)ethyl]phenyl]methanesulfonamide (PubChem CID 170985002) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is N-[4-[2-(5-amino-3-tert-butyl-2-methoxyphenyl)ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-(5-amino-3-tert-butyl-2-methoxyphenyl)ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 170985002 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[4-[2-(5-amino-3-tert-butyl-2-methoxyphenyl)ethyl]phenyl]methanesulfonamide |
| SMILES | COc1c(CCc2ccc(NS(C)(=O)=O)cc2)cc(N)cc1C(C)(C)C |
| InChI | InChI=1S/C20H28N2O3S/c1-20(2,3)18-13-16(21)12-15(19(18)25-4)9-6-14-7-10-17(11-8-14)22-26(5,23)24/h7-8,10-13,22H,6,9,21H2,1-5H3 |
| InChIKey | KADXKKJQDHGMMQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|