About 2-methylhex-5-yn-2-yl 2-(dimethylamino)acetate
2-methylhex-5-yn-2-yl 2-(dimethylamino)acetate (PubChem CID 170985245) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-methylhex-5-yn-2-yl 2-(dimethylamino)acetate.
Molecular Properties
| Compound Name | 2-methylhex-5-yn-2-yl 2-(dimethylamino)acetate |
| PubChem CID | 170985245 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-methylhex-5-yn-2-yl 2-(dimethylamino)acetate |
| SMILES | C#CCCC(C)(C)OC(=O)CN(C)C |
| InChI | InChI=1S/C11H19NO2/c1-6-7-8-11(2,3)14-10(13)9-12(4)5/h1H,7-9H2,2-5H3 |
| InChIKey | QEWTVELMAQSVOX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhex-5-yn-2-yl 2-(dimethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhex-5-yn-2-yl 2-(dimethylamino)acetate?
The IUPAC name of 2-methylhex-5-yn-2-yl 2-(dimethylamino)acetate (CID 170985245) is 2-methylhex-5-yn-2-yl 2-(dimethylamino)acetate.
What is the SMILES notation for 2-methylhex-5-yn-2-yl 2-(dimethylamino)acetate?
The canonical SMILES for 2-methylhex-5-yn-2-yl 2-(dimethylamino)acetate is C#CCCC(C)(C)OC(=O)CN(C)C.
What is the InChIKey of 2-methylhex-5-yn-2-yl 2-(dimethylamino)acetate?
The InChIKey is QEWTVELMAQSVOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-6-7-8-11(2,3)14-10(13)9-12(4)5/h1H,7-9H2,2-5H3.
What are the key properties of 2-methylhex-5-yn-2-yl 2-(dimethylamino)acetate?
2-methylhex-5-yn-2-yl 2-(dimethylamino)acetate has a molecular weight of 197.28 g/mol, XLogP of 1.28, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhex-5-yn-2-yl 2-(dimethylamino)acetate is sourced from PubChem (CID 170985245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).