C14H26O4S2 — CID 58616564
[2,5-dimethyl-5-(3-sulfanylpropanoyloxy)hexan-2-yl] 3-sulfanylpropanoate (PubChem CID 58616564) has the molecular formula C14H26O4S2 and a molecular weight of 322.49 g/mol. Its IUPAC name is [2,5-dimethyl-5-(3-sulfanylpropanoyloxy)hexan-2-yl] 3-sulfanylpropanoate.
| Compound Name | [2,5-dimethyl-5-(3-sulfanylpropanoyloxy)hexan-2-yl] 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 58616564 |
| Molecular Formula | C14H26O4S2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [2,5-dimethyl-5-(3-sulfanylpropanoyloxy)hexan-2-yl] 3-sulfanylpropanoate |
| SMILES | CC(C)(CCC(C)(C)OC(=O)CCS)OC(=O)CCS |
| InChI | InChI=1S/C14H26O4S2/c1-13(2,17-11(15)5-9-19)7-8-14(3,4)18-12(16)6-10-20/h19-20H,5-10H2,1-4H3 |
| InChIKey | QTWJVQJTLGDWNB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|