C22H42O4S2 — CID 59440708
[3,10-diethyl-10-(3-sulfanylpropanoyloxy)dodecan-3-yl] 3-sulfanylpropanoate (PubChem CID 59440708) has the molecular formula C22H42O4S2 and a molecular weight of 434.71 g/mol. Its IUPAC name is [3,10-diethyl-10-(3-sulfanylpropanoyloxy)dodecan-3-yl] 3-sulfanylpropanoate.
| Compound Name | [3,10-diethyl-10-(3-sulfanylpropanoyloxy)dodecan-3-yl] 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 59440708 |
| Molecular Formula | C22H42O4S2 |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | [3,10-diethyl-10-(3-sulfanylpropanoyloxy)dodecan-3-yl] 3-sulfanylpropanoate |
| SMILES | CCC(CC)(CCCCCCC(CC)(CC)OC(=O)CCS)OC(=O)CCS |
| InChI | InChI=1S/C22H42O4S2/c1-5-21(6-2,25-19(23)13-17-27)15-11-9-10-12-16-22(7-3,8-4)26-20(24)14-18-28/h27-28H,5-18H2,1-4H3 |
| InChIKey | VYGXNDKNOYDOKR-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|