C20H30O — CID 170989343
[(4S,6aS,7S,9R)-4,7-dimethyl-9-(2-methylpropyl)-5,6,6a,7,8,9-hexahydro-4H-phenalen-1-yl]methanol (PubChem CID 170989343) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is [(4S,6aS,7S,9R)-4,7-dimethyl-9-(2-methylpropyl)-5,6,6a,7,8,9-hexahydro-4H-phenalen-1-yl]methanol.
| Compound Name | [(4S,6aS,7S,9R)-4,7-dimethyl-9-(2-methylpropyl)-5,6,6a,7,8,9-hexahydro-4H-phenalen-1-yl]methanol |
|---|---|
| PubChem CID | 170989343 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | [(4S,6aS,7S,9R)-4,7-dimethyl-9-(2-methylpropyl)-5,6,6a,7,8,9-hexahydro-4H-phenalen-1-yl]methanol |
| SMILES | CC(C)C[C@@H]1C[C@H](C)[C@@H]2CC[C@H](C)c3ccc(CO)c1c32 |
| InChI | InChI=1S/C20H30O/c1-12(2)9-16-10-14(4)18-7-5-13(3)17-8-6-15(11-21)19(16)20(17)18/h6,8,12-14,16,18,21H,5,7,9-11H2,1-4H3/t13-,14-,16+,18-/m0/s1 |
| InChIKey | ZVOUSPRWBZXKRL-KMCQBPLKSA-N |
| XLogP | 5.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |