About 3-[(E,3R)-3-hydroxybut-1-enyl]-4-(hydroxymethyl)-2H-furan-5-one
3-[(E,3R)-3-hydroxybut-1-enyl]-4-(hydroxymethyl)-2H-furan-5-one (PubChem CID 170989539) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 3-[(E,3R)-3-hydroxybut-1-enyl]-4-(hydroxymethyl)-2H-furan-5-one.
Molecular Properties
| Compound Name | 3-[(E,3R)-3-hydroxybut-1-enyl]-4-(hydroxymethyl)-2H-furan-5-one |
| PubChem CID | 170989539 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3-[(E,3R)-3-hydroxybut-1-enyl]-4-(hydroxymethyl)-2H-furan-5-one |
| SMILES | C[C@@H](O)/C=C/C1=C(CO)C(=O)OC1 |
| InChI | InChI=1S/C9H12O4/c1-6(11)2-3-7-5-13-9(12)8(7)4-10/h2-3,6,10-11H,4-5H2,1H3/b3-2+/t6-/m1/s1 |
| InChIKey | FZTAJHVGJCRZME-YRFDSLTASA-N |
| XLogP | -0.23 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(E,3R)-3-hydroxybut-1-enyl]-4-(hydroxymethyl)-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E,3R)-3-hydroxybut-1-enyl]-4-(hydroxymethyl)-2H-furan-5-one?
The IUPAC name of 3-[(E,3R)-3-hydroxybut-1-enyl]-4-(hydroxymethyl)-2H-furan-5-one (CID 170989539) is 3-[(E,3R)-3-hydroxybut-1-enyl]-4-(hydroxymethyl)-2H-furan-5-one.
What is the SMILES notation for 3-[(E,3R)-3-hydroxybut-1-enyl]-4-(hydroxymethyl)-2H-furan-5-one?
The canonical SMILES for 3-[(E,3R)-3-hydroxybut-1-enyl]-4-(hydroxymethyl)-2H-furan-5-one is C[C@@H](O)/C=C/C1=C(CO)C(=O)OC1.
What is the InChIKey of 3-[(E,3R)-3-hydroxybut-1-enyl]-4-(hydroxymethyl)-2H-furan-5-one?
The InChIKey is FZTAJHVGJCRZME-YRFDSLTASA-N. The full InChI is InChI=1S/C9H12O4/c1-6(11)2-3-7-5-13-9(12)8(7)4-10/h2-3,6,10-11H,4-5H2,1H3/b3-2+/t6-/m1/s1.
What are the key properties of 3-[(E,3R)-3-hydroxybut-1-enyl]-4-(hydroxymethyl)-2H-furan-5-one?
3-[(E,3R)-3-hydroxybut-1-enyl]-4-(hydroxymethyl)-2H-furan-5-one has a molecular weight of 184.19 g/mol, XLogP of -0.23, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E,3R)-3-hydroxybut-1-enyl]-4-(hydroxymethyl)-2H-furan-5-one is sourced from PubChem (CID 170989539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).