About Tricladolide B
Tricladolide B (PubChem CID 11673117) has the molecular formula C13H16O4
and a molecular weight of 236.26 g/mol. Its IUPAC name is 3-[(1E,6E)-8-hydroxyocta-1,6-dienyl]-4-methylfuran-2,5-dione.
Molecular Properties
| Compound Name | Tricladolide B |
| PubChem CID | 11673117 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-[(1E,6E)-8-hydroxyocta-1,6-dienyl]-4-methylfuran-2,5-dione |
| SMILES | CC1=C(C(=O)OC1=O)/C=C/CCC/C=C/CO |
| InChI | InChI=1S/C13H16O4/c1-10-11(13(16)17-12(10)15)8-6-4-2-3-5-7-9-14/h5-8,14H,2-4,9H2,1H3/b7-5+,8-6+ |
| InChIKey | YYVDIYHSDASGBV-KQQUZDAGSA-N |
| XLogP | 1.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | 388 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Tricladolide B with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tricladolide B?
The IUPAC name of Tricladolide B (CID 11673117) is 3-[(1E,6E)-8-hydroxyocta-1,6-dienyl]-4-methylfuran-2,5-dione.
What is the SMILES notation for Tricladolide B?
The canonical SMILES for Tricladolide B is CC1=C(C(=O)OC1=O)/C=C/CCC/C=C/CO.
What is the InChIKey of Tricladolide B?
The InChIKey is YYVDIYHSDASGBV-KQQUZDAGSA-N. The full InChI is InChI=1S/C13H16O4/c1-10-11(13(16)17-12(10)15)8-6-4-2-3-5-7-9-14/h5-8,14H,2-4,9H2,1H3/b7-5+,8-6+.
What are the key properties of Tricladolide B?
Tricladolide B has a molecular weight of 236.26 g/mol, XLogP of 1.80, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Tricladolide B is sourced from PubChem (CID 11673117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).