Tricladolide B

C13H16O4 — CID 11673117

IUPAC3-[(1E,6E)-8-hydroxyocta-1,6-dienyl]-4-methylfuran-2,5-dione
SMILESCC1=C(C(=O)OC1=O)/C=C/CCC/C=C/CO
InChIInChI=1S/C13H16O4/c1-10-11(13(16)17-12(10)15)8-6-4-2-3-5-7-9-14/h5-8,14H,2-4,9H2,1H3/b7-5+,8-6+
InChIKeyYYVDIYHSDASGBV-KQQUZDAGSA-N
MW236.26 g/mol
LogP1.80
Rot. Bonds6

About Tricladolide B

Tricladolide B (PubChem CID 11673117) has the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. Its IUPAC name is 3-[(1E,6E)-8-hydroxyocta-1,6-dienyl]-4-methylfuran-2,5-dione.

Molecular Properties

Compound NameTricladolide B
PubChem CID11673117
Molecular FormulaC13H16O4
Molecular Weight236.26 g/mol
Exact Mass236.10
IUPAC Name3-[(1E,6E)-8-hydroxyocta-1,6-dienyl]-4-methylfuran-2,5-dione
SMILESCC1=C(C(=O)OC1=O)/C=C/CCC/C=C/CO
InChIInChI=1S/C13H16O4/c1-10-11(13(16)17-12(10)15)8-6-4-2-3-5-7-9-14/h5-8,14H,2-4,9H2,1H3/b7-5+,8-6+
InChIKeyYYVDIYHSDASGBV-KQQUZDAGSA-N
XLogP1.80
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms17
Complexity388

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.26
LogP ≤ 51.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze Tricladolide B with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of Tricladolide B?
The IUPAC name of Tricladolide B (CID 11673117) is 3-[(1E,6E)-8-hydroxyocta-1,6-dienyl]-4-methylfuran-2,5-dione.
What is the SMILES notation for Tricladolide B?
The canonical SMILES for Tricladolide B is CC1=C(C(=O)OC1=O)/C=C/CCC/C=C/CO.
What is the InChIKey of Tricladolide B?
The InChIKey is YYVDIYHSDASGBV-KQQUZDAGSA-N. The full InChI is InChI=1S/C13H16O4/c1-10-11(13(16)17-12(10)15)8-6-4-2-3-5-7-9-14/h5-8,14H,2-4,9H2,1H3/b7-5+,8-6+.
What are the key properties of Tricladolide B?
Tricladolide B has a molecular weight of 236.26 g/mol, XLogP of 1.80, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Tricladolide B is sourced from PubChem (CID 11673117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).