Xylaripyone B

C12H14O7 — CID 170989633

IUPAC4-(4-methoxy-3-methoxycarbonyl-6-oxopyran-2-yl)butanoic acid
SMILESCOC1=CC(=O)OC(=C1C(=O)OC)CCCC(=O)O
InChIInChI=1S/C12H14O7/c1-17-8-6-10(15)19-7(4-3-5-9(13)14)11(8)12(16)18-2/h6H,3-5H2,1-2H3,(H,13,14)
InChIKeySAUGKEFMFKDDNF-UHFFFAOYSA-N
MW270.23 g/mol
LogP0.20
Rot. Bonds7

About Xylaripyone B

Xylaripyone B (PubChem CID 170989633) has the molecular formula C12H14O7 and a molecular weight of 270.23 g/mol. Its IUPAC name is 4-(4-methoxy-3-methoxycarbonyl-6-oxopyran-2-yl)butanoic acid.

Molecular Properties

Compound NameXylaripyone B
PubChem CID170989633
Molecular FormulaC12H14O7
Molecular Weight270.23 g/mol
Exact Mass270.07
IUPAC Name4-(4-methoxy-3-methoxycarbonyl-6-oxopyran-2-yl)butanoic acid
SMILESCOC1=CC(=O)OC(=C1C(=O)OC)CCCC(=O)O
InChIInChI=1S/C12H14O7/c1-17-8-6-10(15)19-7(4-3-5-9(13)14)11(8)12(16)18-2/h6H,3-5H2,1-2H3,(H,13,14)
InChIKeySAUGKEFMFKDDNF-UHFFFAOYSA-N
XLogP0.20
TPSA99.10 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms19
Complexity459

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.23
LogP ≤ 50.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Analyze Xylaripyone B with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of Xylaripyone B?
The IUPAC name of Xylaripyone B (CID 170989633) is 4-(4-methoxy-3-methoxycarbonyl-6-oxopyran-2-yl)butanoic acid.
What is the SMILES notation for Xylaripyone B?
The canonical SMILES for Xylaripyone B is COC1=CC(=O)OC(=C1C(=O)OC)CCCC(=O)O.
What is the InChIKey of Xylaripyone B?
The InChIKey is SAUGKEFMFKDDNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O7/c1-17-8-6-10(15)19-7(4-3-5-9(13)14)11(8)12(16)18-2/h6H,3-5H2,1-2H3,(H,13,14).
What are the key properties of Xylaripyone B?
Xylaripyone B has a molecular weight of 270.23 g/mol, XLogP of 0.20, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Xylaripyone B is sourced from PubChem (CID 170989633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).