About Xylaripyone B
Xylaripyone B (PubChem CID 170989633) has the molecular formula C12H14O7
and a molecular weight of 270.23 g/mol. Its IUPAC name is 4-(4-methoxy-3-methoxycarbonyl-6-oxopyran-2-yl)butanoic acid.
Molecular Properties
| Compound Name | Xylaripyone B |
| PubChem CID | 170989633 |
| Molecular Formula | C12H14O7 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-(4-methoxy-3-methoxycarbonyl-6-oxopyran-2-yl)butanoic acid |
| SMILES | COC1=CC(=O)OC(=C1C(=O)OC)CCCC(=O)O |
| InChI | InChI=1S/C12H14O7/c1-17-8-6-10(15)19-7(4-3-5-9(13)14)11(8)12(16)18-2/h6H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | SAUGKEFMFKDDNF-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | 459 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze Xylaripyone B with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Xylaripyone B?
The IUPAC name of Xylaripyone B (CID 170989633) is 4-(4-methoxy-3-methoxycarbonyl-6-oxopyran-2-yl)butanoic acid.
What is the SMILES notation for Xylaripyone B?
The canonical SMILES for Xylaripyone B is COC1=CC(=O)OC(=C1C(=O)OC)CCCC(=O)O.
What is the InChIKey of Xylaripyone B?
The InChIKey is SAUGKEFMFKDDNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O7/c1-17-8-6-10(15)19-7(4-3-5-9(13)14)11(8)12(16)18-2/h6H,3-5H2,1-2H3,(H,13,14).
What are the key properties of Xylaripyone B?
Xylaripyone B has a molecular weight of 270.23 g/mol, XLogP of 0.20, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Xylaripyone B is sourced from PubChem (CID 170989633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).