C15H28O4 — CID 170990833
(1S,2R,4S)-4-[(2S)-7-hydroxy-6-methylhept-5-en-2-yl]-1-methylcyclohexane-1,2,4-triol (PubChem CID 170990833) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is (1S,2R,4S)-4-[(2S)-7-hydroxy-6-methylhept-5-en-2-yl]-1-methylcyclohexane-1,2,4-triol.
| Compound Name | (1S,2R,4S)-4-[(2S)-7-hydroxy-6-methylhept-5-en-2-yl]-1-methylcyclohexane-1,2,4-triol |
|---|---|
| PubChem CID | 170990833 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (1S,2R,4S)-4-[(2S)-7-hydroxy-6-methylhept-5-en-2-yl]-1-methylcyclohexane-1,2,4-triol |
| SMILES | CC(=CCC[C@H](C)[C@]1(O)CC[C@](C)(O)[C@H](O)C1)CO |
| InChI | InChI=1S/C15H28O4/c1-11(10-16)5-4-6-12(2)15(19)8-7-14(3,18)13(17)9-15/h5,12-13,16-19H,4,6-10H2,1-3H3/t12-,13+,14-,15-/m0/s1 |
| InChIKey | NSFRVJIKHGPSCW-XGUBFFRZSA-N |
| XLogP | 1.37 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|