C15H16NO3- — CID 170991435
N-[(2S)-2-(6-methoxynaphthalen-2-yl)propyl]carbamate (PubChem CID 170991435) has the molecular formula C15H16NO3- and a molecular weight of 258.30 g/mol. Its IUPAC name is N-[(2S)-2-(6-methoxynaphthalen-2-yl)propyl]carbamate.
| Compound Name | N-[(2S)-2-(6-methoxynaphthalen-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 170991435 |
| Molecular Formula | C15H16NO3- |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | N-[(2S)-2-(6-methoxynaphthalen-2-yl)propyl]carbamate |
| SMILES | COc1ccc2cc([C@H](C)CNC(=O)[O-])ccc2c1 |
| InChI | InChI=1S/C15H17NO3/c1-10(9-16-15(17)18)11-3-4-13-8-14(19-2)6-5-12(13)7-11/h3-8,10,16H,9H2,1-2H3,(H,17,18)/p-1/t10-/m1/s1 |
| InChIKey | NQZROCCUVCHHBF-SNVBAGLBSA-M |
| XLogP | 1.88 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |