About [(2S)-2-(6-methoxynaphthalen-2-yl)propyl] 2-methylpropanoate
[(2S)-2-(6-methoxynaphthalen-2-yl)propyl] 2-methylpropanoate (PubChem CID 141195522) has the molecular formula C18H22O3
and a molecular weight of 286.37 g/mol. Its IUPAC name is [(2S)-2-(6-methoxynaphthalen-2-yl)propyl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [(2S)-2-(6-methoxynaphthalen-2-yl)propyl] 2-methylpropanoate |
| PubChem CID | 141195522 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | [(2S)-2-(6-methoxynaphthalen-2-yl)propyl] 2-methylpropanoate |
| SMILES | COc1ccc2cc([C@H](C)COC(=O)C(C)C)ccc2c1 |
| InChI | InChI=1S/C18H22O3/c1-12(2)18(19)21-11-13(3)14-5-6-16-10-17(20-4)8-7-15(16)9-14/h5-10,12-13H,11H2,1-4H3/t13-/m1/s1 |
| InChIKey | BLLIAYWYKJZOOL-CYBMUJFWSA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-2-(6-methoxynaphthalen-2-yl)propyl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-(6-methoxynaphthalen-2-yl)propyl] 2-methylpropanoate?
The IUPAC name of [(2S)-2-(6-methoxynaphthalen-2-yl)propyl] 2-methylpropanoate (CID 141195522) is [(2S)-2-(6-methoxynaphthalen-2-yl)propyl] 2-methylpropanoate.
What is the SMILES notation for [(2S)-2-(6-methoxynaphthalen-2-yl)propyl] 2-methylpropanoate?
The canonical SMILES for [(2S)-2-(6-methoxynaphthalen-2-yl)propyl] 2-methylpropanoate is COc1ccc2cc([C@H](C)COC(=O)C(C)C)ccc2c1.
What is the InChIKey of [(2S)-2-(6-methoxynaphthalen-2-yl)propyl] 2-methylpropanoate?
The InChIKey is BLLIAYWYKJZOOL-CYBMUJFWSA-N. The full InChI is InChI=1S/C18H22O3/c1-12(2)18(19)21-11-13(3)14-5-6-16-10-17(20-4)8-7-15(16)9-14/h5-10,12-13H,11H2,1-4H3/t13-/m1/s1.
What are the key properties of [(2S)-2-(6-methoxynaphthalen-2-yl)propyl] 2-methylpropanoate?
[(2S)-2-(6-methoxynaphthalen-2-yl)propyl] 2-methylpropanoate has a molecular weight of 286.37 g/mol, XLogP of 4.15, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-(6-methoxynaphthalen-2-yl)propyl] 2-methylpropanoate is sourced from PubChem (CID 141195522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).