C11H17N3O — CID 170992112
1-[(1,5-dimethylpyrazol-3-yl)methyl]piperidin-4-one (PubChem CID 170992112) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 1-[(1,5-dimethylpyrazol-3-yl)methyl]piperidin-4-one.
| Compound Name | 1-[(1,5-dimethylpyrazol-3-yl)methyl]piperidin-4-one |
|---|---|
| PubChem CID | 170992112 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 1-[(1,5-dimethylpyrazol-3-yl)methyl]piperidin-4-one |
| SMILES | Cc1cc(CN2CCC(=O)CC2)nn1C |
| InChI | InChI=1S/C11H17N3O/c1-9-7-10(12-13(9)2)8-14-5-3-11(15)4-6-14/h7H,3-6,8H2,1-2H3 |
| InChIKey | QRJZFWJDWHDKIF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |