C13H12F3NO3 — CID 170992811
methyl 7-methoxy-1-(2,2,2-trifluoroethyl)indole-6-carboxylate (PubChem CID 170992811) has the molecular formula C13H12F3NO3 and a molecular weight of 287.24 g/mol. Its IUPAC name is methyl 7-methoxy-1-(2,2,2-trifluoroethyl)indole-6-carboxylate.
| Compound Name | methyl 7-methoxy-1-(2,2,2-trifluoroethyl)indole-6-carboxylate |
|---|---|
| PubChem CID | 170992811 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | methyl 7-methoxy-1-(2,2,2-trifluoroethyl)indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2ccn(CC(F)(F)F)c2c1OC |
| InChI | InChI=1S/C13H12F3NO3/c1-19-11-9(12(18)20-2)4-3-8-5-6-17(10(8)11)7-13(14,15)16/h3-6H,7H2,1-2H3 |
| InChIKey | ZZTUTYUMFAOUFY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |