C15H15N3O3 — CID 170992823
methyl 8-(cyclopropylcarbamoylamino)quinoline-6-carboxylate (PubChem CID 170992823) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is methyl 8-(cyclopropylcarbamoylamino)quinoline-6-carboxylate.
| Compound Name | methyl 8-(cyclopropylcarbamoylamino)quinoline-6-carboxylate |
|---|---|
| PubChem CID | 170992823 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | methyl 8-(cyclopropylcarbamoylamino)quinoline-6-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)NC2CC2)c2ncccc2c1 |
| InChI | InChI=1S/C15H15N3O3/c1-21-14(19)10-7-9-3-2-6-16-13(9)12(8-10)18-15(20)17-11-4-5-11/h2-3,6-8,11H,4-5H2,1H3,(H2,17,18,20) |
| InChIKey | IAOYKHYDCOHRST-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |