methyl 8-methoxy-3-tributylstannylquinoline-6-carboxylate

C24H37NO3Sn — CID 170992828

IUPACmethyl 8-methoxy-3-tributylstannylquinoline-6-carboxylate
SMILESCCCC[Sn](CCCC)(CCCC)c1cnc2c(OC)cc(C(=O)OC)cc2c1
InChIInChI=1S/C12H10NO3.3C4H9.Sn/c1-15-10-7-9(12(14)16-2)6-8-4-3-5-13-11(8)10;3*1-3-4-2;/h4-7H,1-2H3;3*1,3-4H2,2H3;
InChIKeyDCGYGSSCVNYLPL-UHFFFAOYSA-N
MW506.28 g/mol
LogP6.09
Rot. Bonds12

About methyl 8-methoxy-3-tributylstannylquinoline-6-carboxylate

methyl 8-methoxy-3-tributylstannylquinoline-6-carboxylate (PubChem CID 170992828) has the molecular formula C24H37NO3Sn and a molecular weight of 506.28 g/mol. Its IUPAC name is methyl 8-methoxy-3-tributylstannylquinoline-6-carboxylate.

Molecular Properties

Compound Namemethyl 8-methoxy-3-tributylstannylquinoline-6-carboxylate
PubChem CID170992828
Molecular FormulaC24H37NO3Sn
Molecular Weight506.28 g/mol
Exact Mass507.18
IUPAC Namemethyl 8-methoxy-3-tributylstannylquinoline-6-carboxylate
SMILESCCCC[Sn](CCCC)(CCCC)c1cnc2c(OC)cc(C(=O)OC)cc2c1
InChIInChI=1S/C12H10NO3.3C4H9.Sn/c1-15-10-7-9(12(14)16-2)6-8-4-3-5-13-11(8)10;3*1-3-4-2;/h4-7H,1-2H3;3*1,3-4H2,2H3;
InChIKeyDCGYGSSCVNYLPL-UHFFFAOYSA-N
XLogP6.09
TPSA48.42 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds12
Heavy Atoms29
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500506.28
LogP ≤ 56.09
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 8-methoxy-3-tributylstannylquinoline-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 8-methoxy-3-tributylstannylquinoline-6-carboxylate?
The IUPAC name of methyl 8-methoxy-3-tributylstannylquinoline-6-carboxylate (CID 170992828) is methyl 8-methoxy-3-tributylstannylquinoline-6-carboxylate.
What is the SMILES notation for methyl 8-methoxy-3-tributylstannylquinoline-6-carboxylate?
The canonical SMILES for methyl 8-methoxy-3-tributylstannylquinoline-6-carboxylate is CCCC[Sn](CCCC)(CCCC)c1cnc2c(OC)cc(C(=O)OC)cc2c1.
What is the InChIKey of methyl 8-methoxy-3-tributylstannylquinoline-6-carboxylate?
The InChIKey is DCGYGSSCVNYLPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10NO3.3C4H9.Sn/c1-15-10-7-9(12(14)16-2)6-8-4-3-5-13-11(8)10;3*1-3-4-2;/h4-7H,1-2H3;3*1,3-4H2,2H3;.
What are the key properties of methyl 8-methoxy-3-tributylstannylquinoline-6-carboxylate?
methyl 8-methoxy-3-tributylstannylquinoline-6-carboxylate has a molecular weight of 506.28 g/mol, XLogP of 6.09, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-methoxy-3-tributylstannylquinoline-6-carboxylate is sourced from PubChem (CID 170992828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).