C25H30N2 — CID 170994719
N,N-bis(4-tert-butylphenyl)pyridin-2-amine (PubChem CID 170994719) has the molecular formula C25H30N2 and a molecular weight of 358.53 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)pyridin-2-amine.
| Compound Name | N,N-bis(4-tert-butylphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 170994719 |
| Molecular Formula | C25H30N2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)pyridin-2-amine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2ccccn2)cc1 |
| InChI | InChI=1S/C25H30N2/c1-24(2,3)19-10-14-21(15-11-19)27(23-9-7-8-18-26-23)22-16-12-20(13-17-22)25(4,5)6/h7-18H,1-6H3 |
| InChIKey | CVWHEBVMKUUVDX-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |