C17H28Cl2N2 — CID 170994863
4-[5-methyl-2-(pyrrolidin-1-ylmethyl)phenyl]piperidine;dihydrochloride (PubChem CID 170994863) has the molecular formula C17H28Cl2N2 and a molecular weight of 331.33 g/mol. Its IUPAC name is 4-[5-methyl-2-(pyrrolidin-1-ylmethyl)phenyl]piperidine;dihydrochloride.
| Compound Name | 4-[5-methyl-2-(pyrrolidin-1-ylmethyl)phenyl]piperidine;dihydrochloride |
|---|---|
| PubChem CID | 170994863 |
| Molecular Formula | C17H28Cl2N2 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-[5-methyl-2-(pyrrolidin-1-ylmethyl)phenyl]piperidine;dihydrochloride |
| SMILES | Cc1ccc(CN2CCCC2)c(C2CCNCC2)c1.Cl.Cl |
| InChI | InChI=1S/C17H26N2.2ClH/c1-14-4-5-16(13-19-10-2-3-11-19)17(12-14)15-6-8-18-9-7-15;;/h4-5,12,15,18H,2-3,6-11,13H2,1H3;2*1H |
| InChIKey | CVICIRBYUDUGCL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |