C18H29N3 — CID 170994872
1-methyl-4-[(4-methyl-2-piperidin-4-ylphenyl)methyl]piperazine (PubChem CID 170994872) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 1-methyl-4-[(4-methyl-2-piperidin-4-ylphenyl)methyl]piperazine.
| Compound Name | 1-methyl-4-[(4-methyl-2-piperidin-4-ylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 170994872 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 1-methyl-4-[(4-methyl-2-piperidin-4-ylphenyl)methyl]piperazine |
| SMILES | Cc1ccc(CN2CCN(C)CC2)c(C2CCNCC2)c1 |
| InChI | InChI=1S/C18H29N3/c1-15-3-4-17(14-21-11-9-20(2)10-12-21)18(13-15)16-5-7-19-8-6-16/h3-4,13,16,19H,5-12,14H2,1-2H3 |
| InChIKey | DDARFYAOEJGSBT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |