C12H9F3O — CID 170994931
2-cyclopropyl-4-ethynyl-1-(trifluoromethoxy)benzene (PubChem CID 170994931) has the molecular formula C12H9F3O and a molecular weight of 226.20 g/mol. Its IUPAC name is 2-cyclopropyl-4-ethynyl-1-(trifluoromethoxy)benzene.
| Compound Name | 2-cyclopropyl-4-ethynyl-1-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 170994931 |
| Molecular Formula | C12H9F3O |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2-cyclopropyl-4-ethynyl-1-(trifluoromethoxy)benzene |
| SMILES | C#Cc1ccc(OC(F)(F)F)c(C2CC2)c1 |
| InChI | InChI=1S/C12H9F3O/c1-2-8-3-6-11(16-12(13,14)15)10(7-8)9-4-5-9/h1,3,6-7,9H,4-5H2 |
| InChIKey | PGXBNKJRMWMJKP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|