C15H16F2N2 — CID 170995643
3-cyclopropyl-4-(3,3-difluoropiperidin-1-yl)benzonitrile (PubChem CID 170995643) has the molecular formula C15H16F2N2 and a molecular weight of 262.30 g/mol. Its IUPAC name is 3-cyclopropyl-4-(3,3-difluoropiperidin-1-yl)benzonitrile.
| Compound Name | 3-cyclopropyl-4-(3,3-difluoropiperidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 170995643 |
| Molecular Formula | C15H16F2N2 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-cyclopropyl-4-(3,3-difluoropiperidin-1-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCCC(F)(F)C2)c(C2CC2)c1 |
| InChI | InChI=1S/C15H16F2N2/c16-15(17)6-1-7-19(10-15)14-5-2-11(9-18)8-13(14)12-3-4-12/h2,5,8,12H,1,3-4,6-7,10H2 |
| InChIKey | WOLORBDWUCJNNC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |