C19H18N2O6 — CID 170999932
4-[2-(pyrrolidin-1-ylmethyl)phenyl]pyridine-2,3,5-tricarboxylic acid (PubChem CID 170999932) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is 4-[2-(pyrrolidin-1-ylmethyl)phenyl]pyridine-2,3,5-tricarboxylic acid.
| Compound Name | 4-[2-(pyrrolidin-1-ylmethyl)phenyl]pyridine-2,3,5-tricarboxylic acid |
|---|---|
| PubChem CID | 170999932 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 4-[2-(pyrrolidin-1-ylmethyl)phenyl]pyridine-2,3,5-tricarboxylic acid |
| SMILES | O=C(O)c1cnc(C(=O)O)c(C(=O)O)c1-c1ccccc1CN1CCCC1 |
| InChI | InChI=1S/C19H18N2O6/c22-17(23)13-9-20-16(19(26)27)15(18(24)25)14(13)12-6-2-1-5-11(12)10-21-7-3-4-8-21/h1-2,5-6,9H,3-4,7-8,10H2,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | YAFPAZOQVHSZSF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |