C8H4Cl2O3 — CID 171006374
2,3-dichloro-5-formylbenzoic acid (PubChem CID 171006374) has the molecular formula C8H4Cl2O3 and a molecular weight of 219.02 g/mol. Its IUPAC name is 2,3-dichloro-5-formylbenzoic acid.
| Compound Name | 2,3-dichloro-5-formylbenzoic acid |
|---|---|
| PubChem CID | 171006374 |
| Molecular Formula | C8H4Cl2O3 |
| Molecular Weight | 219.02 g/mol |
| Exact Mass | 217.95 |
| IUPAC Name | 2,3-dichloro-5-formylbenzoic acid |
| SMILES | O=Cc1cc(Cl)c(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C8H4Cl2O3/c9-6-2-4(3-11)1-5(7(6)10)8(12)13/h1-3H,(H,12,13) |
| InChIKey | BCKSRUILISNEDN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.02 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|