C7H4Br2N2O2S — CID 171007059
3,6-dibromo-2-cyanobenzenesulfonamide (PubChem CID 171007059) has the molecular formula C7H4Br2N2O2S and a molecular weight of 340.00 g/mol. Its IUPAC name is 3,6-dibromo-2-cyanobenzenesulfonamide.
| Compound Name | 3,6-dibromo-2-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 171007059 |
| Molecular Formula | C7H4Br2N2O2S |
| Molecular Weight | 340.00 g/mol |
| Exact Mass | 337.84 |
| IUPAC Name | 3,6-dibromo-2-cyanobenzenesulfonamide |
| SMILES | N#Cc1c(Br)ccc(Br)c1S(N)(=O)=O |
| InChI | InChI=1S/C7H4Br2N2O2S/c8-5-1-2-6(9)7(4(5)3-10)14(11,12)13/h1-2H,(H2,11,12,13) |
| InChIKey | DXCZGLBUQQYFPE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.00 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |