C8H4Br3ClO — CID 171009965
2-bromo-1-(2,4-dibromo-3-chlorophenyl)ethanone (PubChem CID 171009965) has the molecular formula C8H4Br3ClO and a molecular weight of 391.28 g/mol. Its IUPAC name is 2-bromo-1-(2,4-dibromo-3-chlorophenyl)ethanone.
| Compound Name | 2-bromo-1-(2,4-dibromo-3-chlorophenyl)ethanone |
|---|---|
| PubChem CID | 171009965 |
| Molecular Formula | C8H4Br3ClO |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 387.75 |
| IUPAC Name | 2-bromo-1-(2,4-dibromo-3-chlorophenyl)ethanone |
| SMILES | O=C(CBr)c1ccc(Br)c(Cl)c1Br |
| InChI | InChI=1S/C8H4Br3ClO/c9-3-6(13)4-1-2-5(10)8(12)7(4)11/h1-2H,3H2 |
| InChIKey | XLZJXCIBKLADDZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|