C20H13ClN2O2S3 — CID 17101170
(5E)-5-[[2-(4-chlorophenyl)sulfanyl-6-methoxyquinolin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 17101170) has the molecular formula C20H13ClN2O2S3 and a molecular weight of 444.99 g/mol. Its IUPAC name is (5E)-5-[[2-(4-chlorophenyl)sulfanyl-6-methoxyquinolin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2-(4-chlorophenyl)sulfanyl-6-methoxyquinolin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 17101170 |
| Molecular Formula | C20H13ClN2O2S3 |
| Molecular Weight | 444.99 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | (5E)-5-[[2-(4-chlorophenyl)sulfanyl-6-methoxyquinolin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2nc(Sc3ccc(Cl)cc3)c(/C=C3/SC(=S)NC3=O)cc2c1 |
| InChI | InChI=1S/C20H13ClN2O2S3/c1-25-14-4-7-16-11(9-14)8-12(10-17-18(24)23-20(26)28-17)19(22-16)27-15-5-2-13(21)3-6-15/h2-10H,1H3,(H,23,24,26)/b17-10+ |
| InChIKey | ZULXOHAWSSQVKL-LICLKQGHSA-N |
| XLogP | 5.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.99 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|