C22H16ClN3O3S2 — CID 17101168
(5E)-3-acetyl-5-[[2-(4-chlorophenyl)sulfanyl-6-methoxyquinolin-3-yl]methylidene]-2-imino-1,3-thiazolidin-4-one (PubChem CID 17101168) has the molecular formula C22H16ClN3O3S2 and a molecular weight of 469.98 g/mol. Its IUPAC name is (5E)-3-acetyl-5-[[2-(4-chlorophenyl)sulfanyl-6-methoxyquinolin-3-yl]methylidene]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-acetyl-5-[[2-(4-chlorophenyl)sulfanyl-6-methoxyquinolin-3-yl]methylidene]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 17101168 |
| Molecular Formula | C22H16ClN3O3S2 |
| Molecular Weight | 469.98 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | (5E)-3-acetyl-5-[[2-(4-chlorophenyl)sulfanyl-6-methoxyquinolin-3-yl]methylidene]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S/C(=C/c2cc3cc(OC)ccc3nc2Sc2ccc(Cl)cc2)C(=O)N1C(C)=O |
| InChI | InChI=1S/C22H16ClN3O3S2/c1-12(27)26-21(28)19(31-22(26)24)11-14-9-13-10-16(29-2)5-8-18(13)25-20(14)30-17-6-3-15(23)4-7-17/h3-11,24H,1-2H3/b19-11+,24-22- |
| InChIKey | MONWNTPLVBABOT-MSBDOUPJSA-N |
| XLogP | 5.45 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.98 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|