C13H17ClO2 — CID 171019006
ethyl 2-[5-(chloromethyl)-2,3-dimethylphenyl]acetate (PubChem CID 171019006) has the molecular formula C13H17ClO2 and a molecular weight of 240.73 g/mol. Its IUPAC name is ethyl 2-[5-(chloromethyl)-2,3-dimethylphenyl]acetate.
| Compound Name | ethyl 2-[5-(chloromethyl)-2,3-dimethylphenyl]acetate |
|---|---|
| PubChem CID | 171019006 |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | ethyl 2-[5-(chloromethyl)-2,3-dimethylphenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(CCl)cc(C)c1C |
| InChI | InChI=1S/C13H17ClO2/c1-4-16-13(15)7-12-6-11(8-14)5-9(2)10(12)3/h5-6H,4,7-8H2,1-3H3 |
| InChIKey | HPELCVVHCYAUAH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|