C11H12BrF2NO3 — CID 171019228
ethyl 2-[5-amino-2-bromo-4-(difluoromethoxy)phenyl]acetate (PubChem CID 171019228) has the molecular formula C11H12BrF2NO3 and a molecular weight of 324.12 g/mol. Its IUPAC name is ethyl 2-[5-amino-2-bromo-4-(difluoromethoxy)phenyl]acetate.
| Compound Name | ethyl 2-[5-amino-2-bromo-4-(difluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 171019228 |
| Molecular Formula | C11H12BrF2NO3 |
| Molecular Weight | 324.12 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | ethyl 2-[5-amino-2-bromo-4-(difluoromethoxy)phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(N)c(OC(F)F)cc1Br |
| InChI | InChI=1S/C11H12BrF2NO3/c1-2-17-10(16)4-6-3-8(15)9(5-7(6)12)18-11(13)14/h3,5,11H,2,4,15H2,1H3 |
| InChIKey | ATRXGVZKHJFMDU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.12 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|