2-(2-amino-6-chloro-3-cyanophenyl)acetic acid

C9H7ClN2O2 — CID 171021483

IUPAC2-(2-amino-6-chloro-3-cyanophenyl)acetic acid
SMILESN#Cc1ccc(Cl)c(CC(=O)O)c1N
InChIInChI=1S/C9H7ClN2O2/c10-7-2-1-5(4-11)9(12)6(7)3-8(13)14/h1-2H,3,12H2,(H,13,14)
InChIKeyNBKLOXFPJYENHW-UHFFFAOYSA-N
MW210.62 g/mol
LogP1.42
Rot. Bonds2

About 2-(2-amino-6-chloro-3-cyanophenyl)acetic acid

2-(2-amino-6-chloro-3-cyanophenyl)acetic acid (PubChem CID 171021483) has the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. Its IUPAC name is 2-(2-amino-6-chloro-3-cyanophenyl)acetic acid.

Molecular Properties

Compound Name2-(2-amino-6-chloro-3-cyanophenyl)acetic acid
PubChem CID171021483
Molecular FormulaC9H7ClN2O2
Molecular Weight210.62 g/mol
Exact Mass210.02
IUPAC Name2-(2-amino-6-chloro-3-cyanophenyl)acetic acid
SMILESN#Cc1ccc(Cl)c(CC(=O)O)c1N
InChIInChI=1S/C9H7ClN2O2/c10-7-2-1-5(4-11)9(12)6(7)3-8(13)14/h1-2H,3,12H2,(H,13,14)
InChIKeyNBKLOXFPJYENHW-UHFFFAOYSA-N
XLogP1.42
TPSA87.11 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.62
LogP ≤ 51.42
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 2-(2-amino-6-chloro-3-cyanophenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(2,6-dichloro-3-cyanophenyl)acetic acid
CID 121278950
2-[6-chloro-2-(chloromethyl)-3-cyanophenyl]acetic acid
CID 131479799
2-(2-bromo-6-chloro-3-cyanophenyl)acetic acid
CID 119021333
2-(2-amino-3-cyano-6-fluorophenyl)acetic acid
CID 171011236
2-(6-amino-2-chloro-3-cyanophenyl)acetic acid
CID 171021725
2-[2-amino-3-cyano-6-(difluoromethoxy)phenyl]acetic acid
CID 171022267
2-(4-amino-5-chloro-2-cyanophenyl)acetic acid
CID 171021426
2-[2-chloro-3-(chloromethyl)-4-cyanophenyl]acetic acid
CID 131469105
2-[4-(aminomethyl)-2-chloro-6-cyanophenyl]acetic acid
CID 134655781
2-[6-(chloromethyl)-3-cyano-2-sulfanylphenyl]acetic acid
CID 134640354
2-[4-amino-5-cyano-2-(difluoromethyl)-3-pyridinyl]acetic acid
CID 134673432
2-(3-cyano-2,6-diethylphenyl)acetic acid
CID 135742920

Frequently Asked Questions

What is the IUPAC name of 2-(2-amino-6-chloro-3-cyanophenyl)acetic acid?
The IUPAC name of 2-(2-amino-6-chloro-3-cyanophenyl)acetic acid (CID 171021483) is 2-(2-amino-6-chloro-3-cyanophenyl)acetic acid.
What is the SMILES notation for 2-(2-amino-6-chloro-3-cyanophenyl)acetic acid?
The canonical SMILES for 2-(2-amino-6-chloro-3-cyanophenyl)acetic acid is N#Cc1ccc(Cl)c(CC(=O)O)c1N.
What is the InChIKey of 2-(2-amino-6-chloro-3-cyanophenyl)acetic acid?
The InChIKey is NBKLOXFPJYENHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2O2/c10-7-2-1-5(4-11)9(12)6(7)3-8(13)14/h1-2H,3,12H2,(H,13,14).
What are the key properties of 2-(2-amino-6-chloro-3-cyanophenyl)acetic acid?
2-(2-amino-6-chloro-3-cyanophenyl)acetic acid has a molecular weight of 210.62 g/mol, XLogP of 1.42, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-6-chloro-3-cyanophenyl)acetic acid is sourced from PubChem (CID 171021483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).