C8H7F3N2O3 — CID 171028893
methyl 2-amino-3-(trifluoromethoxy)pyridine-4-carboxylate (PubChem CID 171028893) has the molecular formula C8H7F3N2O3 and a molecular weight of 236.15 g/mol. Its IUPAC name is methyl 2-amino-3-(trifluoromethoxy)pyridine-4-carboxylate.
| Compound Name | methyl 2-amino-3-(trifluoromethoxy)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 171028893 |
| Molecular Formula | C8H7F3N2O3 |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | methyl 2-amino-3-(trifluoromethoxy)pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(N)c1OC(F)(F)F |
| InChI | InChI=1S/C8H7F3N2O3/c1-15-7(14)4-2-3-13-6(12)5(4)16-8(9,10)11/h2-3H,1H3,(H2,12,13) |
| InChIKey | GOFMJUHUVFGNBX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |