C13H15BrF2N2O2 — CID 171037100
[4-bromo-2-(difluoromethoxy)phenyl]-[(3R)-3-methylpiperazin-1-yl]methanone (PubChem CID 171037100) has the molecular formula C13H15BrF2N2O2 and a molecular weight of 349.18 g/mol. Its IUPAC name is [4-bromo-2-(difluoromethoxy)phenyl]-[(3R)-3-methylpiperazin-1-yl]methanone.
| Compound Name | [4-bromo-2-(difluoromethoxy)phenyl]-[(3R)-3-methylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 171037100 |
| Molecular Formula | C13H15BrF2N2O2 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | [4-bromo-2-(difluoromethoxy)phenyl]-[(3R)-3-methylpiperazin-1-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)c2ccc(Br)cc2OC(F)F)CCN1 |
| InChI | InChI=1S/C13H15BrF2N2O2/c1-8-7-18(5-4-17-8)12(19)10-3-2-9(14)6-11(10)20-13(15)16/h2-3,6,8,13,17H,4-5,7H2,1H3/t8-/m1/s1 |
| InChIKey | RGOUMLNHAHBQOC-MRVPVSSYSA-N |
| XLogP | 2.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |