C11H14F2N2O2S — CID 119580886
[3-(difluoromethoxy)thiophen-2-yl]-(3-methylpiperazin-1-yl)methanone (PubChem CID 119580886) has the molecular formula C11H14F2N2O2S and a molecular weight of 276.31 g/mol. Its IUPAC name is [3-(difluoromethoxy)thiophen-2-yl]-(3-methylpiperazin-1-yl)methanone.
| Compound Name | [3-(difluoromethoxy)thiophen-2-yl]-(3-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 119580886 |
| Molecular Formula | C11H14F2N2O2S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | [3-(difluoromethoxy)thiophen-2-yl]-(3-methylpiperazin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2sccc2OC(F)F)CCN1 |
| InChI | InChI=1S/C11H14F2N2O2S/c1-7-6-15(4-3-14-7)10(16)9-8(2-5-18-9)17-11(12)13/h2,5,7,11,14H,3-4,6H2,1H3 |
| InChIKey | FWQCHSOYBHEAJH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |