C13H15F2NO4S — CID 75387914
[1-[3-(difluoromethoxy)thiophene-2-carbonyl]piperidin-3-yl] acetate (PubChem CID 75387914) has the molecular formula C13H15F2NO4S and a molecular weight of 319.33 g/mol. Its IUPAC name is [1-[3-(difluoromethoxy)thiophene-2-carbonyl]piperidin-3-yl] acetate.
| Compound Name | [1-[3-(difluoromethoxy)thiophene-2-carbonyl]piperidin-3-yl] acetate |
|---|---|
| PubChem CID | 75387914 |
| Molecular Formula | C13H15F2NO4S |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | [1-[3-(difluoromethoxy)thiophene-2-carbonyl]piperidin-3-yl] acetate |
| SMILES | CC(=O)OC1CCCN(C(=O)c2sccc2OC(F)F)C1 |
| InChI | InChI=1S/C13H15F2NO4S/c1-8(17)19-9-3-2-5-16(7-9)12(18)11-10(4-6-21-11)20-13(14)15/h4,6,9,13H,2-3,5,7H2,1H3 |
| InChIKey | AGFINOYPOUPIAP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |